C10H14N2O — CID 143088905
1-[3-ethenyl-4-(ethylideneamino)-2,5-dihydropyrrol-1-yl]ethanone (PubChem CID 143088905) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-[3-ethenyl-4-(ethylideneamino)-2,5-dihydropyrrol-1-yl]ethanone.
| Compound Name | 1-[3-ethenyl-4-(ethylideneamino)-2,5-dihydropyrrol-1-yl]ethanone |
|---|---|
| PubChem CID | 143088905 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1-[3-ethenyl-4-(ethylideneamino)-2,5-dihydropyrrol-1-yl]ethanone |
| SMILES | C=CC1=C(/N=C/C)CN(C(C)=O)C1 |
| InChI | InChI=1S/C10H14N2O/c1-4-9-6-12(8(3)13)7-10(9)11-5-2/h4-5H,1,6-7H2,2-3H3/b11-5+ |
| InChIKey | JDZLZCHLKLHNEK-VZUCSPMQSA-N |
| XLogP | 1.38 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|