C8H10N2O — CID 167479306
4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one (PubChem CID 167479306) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one.
| Compound Name | 4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 167479306 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 4-ethenyl-3-(ethylideneamino)-1,2-dihydropyrrol-5-one |
| SMILES | C=CC1=C(/N=C/C)CNC1=O |
| InChI | InChI=1S/C8H10N2O/c1-3-6-7(9-4-2)5-10-8(6)11/h3-4H,1,5H2,2H3,(H,10,11)/b9-4+ |
| InChIKey | UFTYEXASIUPKBT-RUDMXATFSA-N |
| XLogP | 0.65 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|