C9H14N2O — CID 143711201
ethane;4-ethenyl-3-(methylideneamino)-1,2-dihydropyrrol-5-one (PubChem CID 143711201) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is ethane;4-ethenyl-3-(methylideneamino)-1,2-dihydropyrrol-5-one.
| Compound Name | ethane;4-ethenyl-3-(methylideneamino)-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 143711201 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | ethane;4-ethenyl-3-(methylideneamino)-1,2-dihydropyrrol-5-one |
| SMILES | C=CC1=C(N=C)CNC1=O.CC |
| InChI | InChI=1S/C7H8N2O.C2H6/c1-3-5-6(8-2)4-9-7(5)10;1-2/h3H,1-2,4H2,(H,9,10);1-2H3 |
| InChIKey | ABPRIJNVRDQRTB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|