C14H28N2O — CID 143818770
ethane;5-ethenyl-4-(methylideneamino)-2,3-dihydro-1H-pyridin-6-one (PubChem CID 143818770) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is ethane;5-ethenyl-4-(methylideneamino)-2,3-dihydro-1H-pyridin-6-one.
| Compound Name | ethane;5-ethenyl-4-(methylideneamino)-2,3-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 143818770 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | ethane;5-ethenyl-4-(methylideneamino)-2,3-dihydro-1H-pyridin-6-one |
| SMILES | C=CC1=C(N=C)CCNC1=O.CC.CC.CC |
| InChI | InChI=1S/C8H10N2O.3C2H6/c1-3-6-7(9-2)4-5-10-8(6)11;3*1-2/h3H,1-2,4-5H2,(H,10,11);3*1-2H3 |
| InChIKey | BTRTZKISLPMUJK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|