C13H7Br2F5O3S2 — CID 142587795
3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid (PubChem CID 142587795) has the molecular formula C13H7Br2F5O3S2 and a molecular weight of 530.13 g/mol. Its IUPAC name is 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid.
| Compound Name | 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid |
|---|---|
| PubChem CID | 142587795 |
| Molecular Formula | C13H7Br2F5O3S2 |
| Molecular Weight | 530.13 g/mol |
| Exact Mass | 527.81 |
| IUPAC Name | 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(S(=O)c2cc(Br)cc(S(F)(F)(F)(F)F)c2)c1 |
| InChI | InChI=1S/C13H7Br2F5O3S2/c14-8-1-7(13(21)22)2-10(3-8)24(23)11-4-9(15)5-12(6-11)25(16,17,18,19)20/h1-6H,(H,21,22) |
| InChIKey | KZKSIKCKOFQNJX-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.13 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |