About 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid
3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid (PubChem CID 142587795) has the molecular formula C13H7Br2F5O3S2
and a molecular weight of 530.13 g/mol. Its IUPAC name is 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid.
Molecular Properties
| Compound Name | 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid |
| PubChem CID | 142587795 |
| Molecular Formula | C13H7Br2F5O3S2 |
| Molecular Weight | 530.13 g/mol |
| Exact Mass | 527.81 |
| IUPAC Name | 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(S(=O)c2cc(Br)cc(S(F)(F)(F)(F)F)c2)c1 |
| InChI | InChI=1S/C13H7Br2F5O3S2/c14-8-1-7(13(21)22)2-10(3-8)24(23)11-4-9(15)5-12(6-11)25(16,17,18,19)20/h1-6H,(H,21,22) |
| InChIKey | KZKSIKCKOFQNJX-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.13 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid?
The IUPAC name of 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid (CID 142587795) is 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid.
What is the SMILES notation for 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid?
The canonical SMILES for 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid is O=C(O)c1cc(Br)cc(S(=O)c2cc(Br)cc(S(F)(F)(F)(F)F)c2)c1.
What is the InChIKey of 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid?
The InChIKey is KZKSIKCKOFQNJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Br2F5O3S2/c14-8-1-7(13(21)22)2-10(3-8)24(23)11-4-9(15)5-12(6-11)25(16,17,18,19)20/h1-6H,(H,21,22).
What are the key properties of 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid?
3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid has a molecular weight of 530.13 g/mol, XLogP of 6.73, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-[3-bromo-5-(pentafluoro-λ6-sulfanyl)phenyl]sulfinylbenzoic acid is sourced from PubChem (CID 142587795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).