2-(3,5-dibromophenyl)-2-oxoacetic acid

C8H4Br2O3 — CID 175783678

IUPAC2-(3,5-dibromophenyl)-2-oxoacetic acid
SMILESO=C(O)C(=O)c1cc(Br)cc(Br)c1
InChIInChI=1S/C8H4Br2O3/c9-5-1-4(2-6(10)3-5)7(11)8(12)13/h1-3H,(H,12,13)
InChIKeyDCRUEPFBKRTBKC-UHFFFAOYSA-N
MW307.93 g/mol
LogP2.48
Rot. Bonds2

About 2-(3,5-dibromophenyl)-2-oxoacetic acid

2-(3,5-dibromophenyl)-2-oxoacetic acid (PubChem CID 175783678) has the molecular formula C8H4Br2O3 and a molecular weight of 307.93 g/mol. Its IUPAC name is 2-(3,5-dibromophenyl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(3,5-dibromophenyl)-2-oxoacetic acid
PubChem CID175783678
Molecular FormulaC8H4Br2O3
Molecular Weight307.93 g/mol
Exact Mass305.85
IUPAC Name2-(3,5-dibromophenyl)-2-oxoacetic acid
SMILESO=C(O)C(=O)c1cc(Br)cc(Br)c1
InChIInChI=1S/C8H4Br2O3/c9-5-1-4(2-6(10)3-5)7(11)8(12)13/h1-3H,(H,12,13)
InChIKeyDCRUEPFBKRTBKC-UHFFFAOYSA-N
XLogP2.48
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.93
LogP ≤ 52.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(3,5-dibromophenyl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dibromophenyl)-2-oxoacetic acid?
The IUPAC name of 2-(3,5-dibromophenyl)-2-oxoacetic acid (CID 175783678) is 2-(3,5-dibromophenyl)-2-oxoacetic acid.
What is the SMILES notation for 2-(3,5-dibromophenyl)-2-oxoacetic acid?
The canonical SMILES for 2-(3,5-dibromophenyl)-2-oxoacetic acid is O=C(O)C(=O)c1cc(Br)cc(Br)c1.
What is the InChIKey of 2-(3,5-dibromophenyl)-2-oxoacetic acid?
The InChIKey is DCRUEPFBKRTBKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Br2O3/c9-5-1-4(2-6(10)3-5)7(11)8(12)13/h1-3H,(H,12,13).
What are the key properties of 2-(3,5-dibromophenyl)-2-oxoacetic acid?
2-(3,5-dibromophenyl)-2-oxoacetic acid has a molecular weight of 307.93 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dibromophenyl)-2-oxoacetic acid is sourced from PubChem (CID 175783678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).