C20H22ClN3O4S2 — CID 142588069
1-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[5-(1-hydroxycyclobutyl)-1,3-thiazol-2-yl]sulfonyl]urea (PubChem CID 142588069) has the molecular formula C20H22ClN3O4S2 and a molecular weight of 468.00 g/mol. Its IUPAC name is 1-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[5-(1-hydroxycyclobutyl)-1,3-thiazol-2-yl]sulfonyl]urea.
| Compound Name | 1-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[5-(1-hydroxycyclobutyl)-1,3-thiazol-2-yl]sulfonyl]urea |
|---|---|
| PubChem CID | 142588069 |
| Molecular Formula | C20H22ClN3O4S2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 1-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[5-(1-hydroxycyclobutyl)-1,3-thiazol-2-yl]sulfonyl]urea |
| SMILES | O=C(Nc1c2c(c(Cl)c3c1CCC3)CCC2)NS(=O)(=O)c1ncc(C2(O)CCC2)s1 |
| InChI | InChI=1S/C20H22ClN3O4S2/c21-16-11-4-1-6-13(11)17(14-7-2-5-12(14)16)23-18(25)24-30(27,28)19-22-10-15(29-19)20(26)8-3-9-20/h10,26H,1-9H2,(H2,23,24,25) |
| InChIKey | KTQNQNDJFFQGOT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |