C21H26N4O4S2 — CID 166572692
1-[(7-hydroxy-7-methyl-5,6-dihydro-4H-1,3-benzothiazol-2-yl)sulfonyl]-3-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea (PubChem CID 166572692) has the molecular formula C21H26N4O4S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-[(7-hydroxy-7-methyl-5,6-dihydro-4H-1,3-benzothiazol-2-yl)sulfonyl]-3-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea.
| Compound Name | 1-[(7-hydroxy-7-methyl-5,6-dihydro-4H-1,3-benzothiazol-2-yl)sulfonyl]-3-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea |
|---|---|
| PubChem CID | 166572692 |
| Molecular Formula | C21H26N4O4S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 1-[(7-hydroxy-7-methyl-5,6-dihydro-4H-1,3-benzothiazol-2-yl)sulfonyl]-3-(4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea |
| SMILES | CC1CCc2c1nc1c(c2NC(=O)NS(=O)(=O)c2nc3c(s2)C(C)(O)CCC3)CCC1 |
| InChI | InChI=1S/C21H26N4O4S2/c1-11-8-9-13-16(11)22-14-6-3-5-12(14)17(13)24-19(26)25-31(28,29)20-23-15-7-4-10-21(2,27)18(15)30-20/h11,27H,3-10H2,1-2H3,(H2,22,24,25,26) |
| InChIKey | VJUADWYULJELCM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |