C19H28ClF2NOSi — CID 142588514
tert-butyl-[2-[(2R)-5-(2-chloro-4,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-yloxy]-dimethylsilane (PubChem CID 142588514) has the molecular formula C19H28ClF2NOSi and a molecular weight of 387.97 g/mol. Its IUPAC name is tert-butyl-[2-[(2R)-5-(2-chloro-4,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-yloxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(2R)-5-(2-chloro-4,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-yloxy]-dimethylsilane |
|---|---|
| PubChem CID | 142588514 |
| Molecular Formula | C19H28ClF2NOSi |
| Molecular Weight | 387.97 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | tert-butyl-[2-[(2R)-5-(2-chloro-4,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-yloxy]-dimethylsilane |
| SMILES | CC(C)(O[Si](C)(C)C(C)(C)C)[C@H]1CCC(c2cc(F)c(F)cc2Cl)=N1 |
| InChI | InChI=1S/C19H28ClF2NOSi/c1-18(2,3)25(6,7)24-19(4,5)17-9-8-16(23-17)12-10-14(21)15(22)11-13(12)20/h10-11,17H,8-9H2,1-7H3/t17-/m1/s1 |
| InChIKey | ZBECWNXPLXZVBW-QGZVFWFLSA-N |
| XLogP | 6.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.97 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|