C13H14ClF2NO — CID 142588567
2-[(2R)-5-(2-chloro-4,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-ol (PubChem CID 142588567) has the molecular formula C13H14ClF2NO and a molecular weight of 273.71 g/mol. Its IUPAC name is 2-[(2R)-5-(2-chloro-4,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-ol.
| Compound Name | 2-[(2R)-5-(2-chloro-4,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 142588567 |
| Molecular Formula | C13H14ClF2NO |
| Molecular Weight | 273.71 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[(2R)-5-(2-chloro-4,5-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1CCC(c2cc(F)c(F)cc2Cl)=N1 |
| InChI | InChI=1S/C13H14ClF2NO/c1-13(2,18)12-4-3-11(17-12)7-5-9(15)10(16)6-8(7)14/h5-6,12,18H,3-4H2,1-2H3/t12-/m1/s1 |
| InChIKey | MKHISUHNZJQFQW-GFCCVEGCSA-N |
| XLogP | 3.34 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|