C17H21ClF3NO — CID 11727747
4-(4-chlorophenyl)-4-cyclohexylimino-1,1,1-trifluoro-2-methylbutan-2-ol (PubChem CID 11727747) has the molecular formula C17H21ClF3NO and a molecular weight of 347.81 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-cyclohexylimino-1,1,1-trifluoro-2-methylbutan-2-ol.
| Compound Name | 4-(4-chlorophenyl)-4-cyclohexylimino-1,1,1-trifluoro-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 11727747 |
| Molecular Formula | C17H21ClF3NO |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-(4-chlorophenyl)-4-cyclohexylimino-1,1,1-trifluoro-2-methylbutan-2-ol |
| SMILES | CC(O)(C/C(=N\C1CCCCC1)c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H21ClF3NO/c1-16(23,17(19,20)21)11-15(12-7-9-13(18)10-8-12)22-14-5-3-2-4-6-14/h7-10,14,23H,2-6,11H2,1H3/b22-15+ |
| InChIKey | IIHZULDDQGQPFD-PXLXIMEGSA-N |
| XLogP | 5.17 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|