C19H30ClNOSi — CID 142588636
tert-butyl-[2-[(2R)-5-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-yloxy]-dimethylsilane (PubChem CID 142588636) has the molecular formula C19H30ClNOSi and a molecular weight of 351.99 g/mol. Its IUPAC name is tert-butyl-[2-[(2R)-5-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-yloxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(2R)-5-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-yloxy]-dimethylsilane |
|---|---|
| PubChem CID | 142588636 |
| Molecular Formula | C19H30ClNOSi |
| Molecular Weight | 351.99 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | tert-butyl-[2-[(2R)-5-(3-chlorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]propan-2-yloxy]-dimethylsilane |
| SMILES | CC(C)(O[Si](C)(C)C(C)(C)C)[C@H]1CCC(c2cccc(Cl)c2)=N1 |
| InChI | InChI=1S/C19H30ClNOSi/c1-18(2,3)23(6,7)22-19(4,5)17-12-11-16(21-17)14-9-8-10-15(20)13-14/h8-10,13,17H,11-12H2,1-7H3/t17-/m1/s1 |
| InChIKey | JFHQKYWPNOXYTN-QGZVFWFLSA-N |
| XLogP | 6.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.99 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|