C22H26N4O4Se2 — CID 142589380
(2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-phenylpropanoyl]amino]ethyldiselanyl]ethyl]-3-phenylpropanamide (PubChem CID 142589380) has the molecular formula C22H26N4O4Se2 and a molecular weight of 568.39 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-phenylpropanoyl]amino]ethyldiselanyl]ethyl]-3-phenylpropanamide.
| Compound Name | (2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-phenylpropanoyl]amino]ethyldiselanyl]ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 142589380 |
| Molecular Formula | C22H26N4O4Se2 |
| Molecular Weight | 568.39 g/mol |
| Exact Mass | 570.03 |
| IUPAC Name | (2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-phenylpropanoyl]amino]ethyldiselanyl]ethyl]-3-phenylpropanamide |
| SMILES | O=C(NCC[Se][Se]CCNC(=O)/C(Cc1ccccc1)=N/O)/C(Cc1ccccc1)=N/O |
| InChI | InChI=1S/C22H26N4O4Se2/c27-21(19(25-29)15-17-7-3-1-4-8-17)23-11-13-31-32-14-12-24-22(28)20(26-30)16-18-9-5-2-6-10-18/h1-10,29-30H,11-16H2,(H,23,27)(H,24,28)/b25-19+,26-20+ |
| InChIKey | XYEKBBJMDAUIRZ-FQHZWJPGSA-N |
| XLogP | 1.52 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|