C30H42N4O4Se2 — CID 142589363
(2E)-3-(4-tert-butylphenyl)-N-[2-[2-[[(2E)-3-(4-tert-butylphenyl)-2-hydroxyiminopropanoyl]amino]ethyldiselanyl]ethyl]-2-hydroxyiminopropanamide (PubChem CID 142589363) has the molecular formula C30H42N4O4Se2 and a molecular weight of 680.61 g/mol. Its IUPAC name is (2E)-3-(4-tert-butylphenyl)-N-[2-[2-[[(2E)-3-(4-tert-butylphenyl)-2-hydroxyiminopropanoyl]amino]ethyldiselanyl]ethyl]-2-hydroxyiminopropanamide.
| Compound Name | (2E)-3-(4-tert-butylphenyl)-N-[2-[2-[[(2E)-3-(4-tert-butylphenyl)-2-hydroxyiminopropanoyl]amino]ethyldiselanyl]ethyl]-2-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 142589363 |
| Molecular Formula | C30H42N4O4Se2 |
| Molecular Weight | 680.61 g/mol |
| Exact Mass | 682.15 |
| IUPAC Name | (2E)-3-(4-tert-butylphenyl)-N-[2-[2-[[(2E)-3-(4-tert-butylphenyl)-2-hydroxyiminopropanoyl]amino]ethyldiselanyl]ethyl]-2-hydroxyiminopropanamide |
| SMILES | CC(C)(C)c1ccc(C/C(=N\O)C(=O)NCC[Se][Se]CCNC(=O)/C(Cc2ccc(C(C)(C)C)cc2)=N/O)cc1 |
| InChI | InChI=1S/C30H42N4O4Se2/c1-29(2,3)23-11-7-21(8-12-23)19-25(33-37)27(35)31-15-17-39-40-18-16-32-28(36)26(34-38)20-22-9-13-24(14-10-22)30(4,5)6/h7-14,37-38H,15-20H2,1-6H3,(H,31,35)(H,32,36)/b33-25+,34-26+ |
| InChIKey | IBXIAWUXJAUZGT-BCEWYCLDSA-N |
| XLogP | 4.12 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|