C30H30N4O4Se2 — CID 142589372
(2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-naphthalen-2-ylpropanoyl]amino]ethyldiselanyl]ethyl]-3-naphthalen-2-ylpropanamide (PubChem CID 142589372) has the molecular formula C30H30N4O4Se2 and a molecular weight of 668.51 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-naphthalen-2-ylpropanoyl]amino]ethyldiselanyl]ethyl]-3-naphthalen-2-ylpropanamide.
| Compound Name | (2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-naphthalen-2-ylpropanoyl]amino]ethyldiselanyl]ethyl]-3-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 142589372 |
| Molecular Formula | C30H30N4O4Se2 |
| Molecular Weight | 668.51 g/mol |
| Exact Mass | 670.06 |
| IUPAC Name | (2E)-2-hydroxyimino-N-[2-[2-[[(2E)-2-hydroxyimino-3-naphthalen-2-ylpropanoyl]amino]ethyldiselanyl]ethyl]-3-naphthalen-2-ylpropanamide |
| SMILES | O=C(NCC[Se][Se]CCNC(=O)/C(Cc1ccc2ccccc2c1)=N/O)/C(Cc1ccc2ccccc2c1)=N/O |
| InChI | InChI=1S/C30H30N4O4Se2/c35-29(27(33-37)19-21-9-11-23-5-1-3-7-25(23)17-21)31-13-15-39-40-16-14-32-30(36)28(34-38)20-22-10-12-24-6-2-4-8-26(24)18-22/h1-12,17-18,37-38H,13-16,19-20H2,(H,31,35)(H,32,36)/b33-27+,34-28+ |
| InChIKey | CVRYQLKHTNWXKN-SWMYPXFDSA-N |
| XLogP | 3.83 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|