C28H41N5O2 — CID 142589632
7-[(1-acetylpiperidin-4-yl)amino]-2-[(5E)-6-(aminomethyl)-5-ethenylocta-5,7-dienyl]-4-ethyl-3,4-dihydro-2,6-naphthyridin-1-one (PubChem CID 142589632) has the molecular formula C28H41N5O2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 7-[(1-acetylpiperidin-4-yl)amino]-2-[(5E)-6-(aminomethyl)-5-ethenylocta-5,7-dienyl]-4-ethyl-3,4-dihydro-2,6-naphthyridin-1-one.
| Compound Name | 7-[(1-acetylpiperidin-4-yl)amino]-2-[(5E)-6-(aminomethyl)-5-ethenylocta-5,7-dienyl]-4-ethyl-3,4-dihydro-2,6-naphthyridin-1-one |
|---|---|
| PubChem CID | 142589632 |
| Molecular Formula | C28H41N5O2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | 7-[(1-acetylpiperidin-4-yl)amino]-2-[(5E)-6-(aminomethyl)-5-ethenylocta-5,7-dienyl]-4-ethyl-3,4-dihydro-2,6-naphthyridin-1-one |
| SMILES | C=C/C(CN)=C(\C=C)CCCCN1CC(CC)c2cnc(NC3CCN(C(C)=O)CC3)cc2C1=O |
| InChI | InChI=1S/C28H41N5O2/c1-5-21(22(6-2)17-29)10-8-9-13-33-19-23(7-3)26-18-30-27(16-25(26)28(33)35)31-24-11-14-32(15-12-24)20(4)34/h5-6,16,18,23-24H,1-2,7-15,17,19,29H2,3-4H3,(H,30,31)/b22-21- |
| InChIKey | YCOKAHGYXSHSON-DQRAZIAOSA-N |
| XLogP | 4.25 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|