C18H15F3N4O3 — CID 142592276
(4S)-4-methyl-3-(5-methyl-1,2-oxazol-3-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 142592276) has the molecular formula C18H15F3N4O3 and a molecular weight of 392.34 g/mol. Its IUPAC name is (4S)-4-methyl-3-(5-methyl-1,2-oxazol-3-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | (4S)-4-methyl-3-(5-methyl-1,2-oxazol-3-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 142592276 |
| Molecular Formula | C18H15F3N4O3 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (4S)-4-methyl-3-(5-methyl-1,2-oxazol-3-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | Cc1cc(-c2onc3c2[C@H](C)N(C(=O)Nc2cc(F)c(F)c(F)c2)CC3)no1 |
| InChI | InChI=1S/C18H15F3N4O3/c1-8-5-14(24-27-8)17-15-9(2)25(4-3-13(15)23-28-17)18(26)22-10-6-11(19)16(21)12(20)7-10/h5-7,9H,3-4H2,1-2H3,(H,22,26)/t9-/m0/s1 |
| InChIKey | VWQNYYJOLNMUOB-VIFPVBQESA-N |
| XLogP | 4.21 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|