C20H15F4N3O2 — CID 142592291
(6S)-3-(3-fluorophenyl)-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 142592291) has the molecular formula C20H15F4N3O2 and a molecular weight of 405.35 g/mol. Its IUPAC name is (6S)-3-(3-fluorophenyl)-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | (6S)-3-(3-fluorophenyl)-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 142592291 |
| Molecular Formula | C20H15F4N3O2 |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (6S)-3-(3-fluorophenyl)-6-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | C[C@H]1Cc2noc(-c3cccc(F)c3)c2CN1C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C20H15F4N3O2/c1-10-5-17-14(19(29-26-17)11-3-2-4-12(21)6-11)9-27(10)20(28)25-13-7-15(22)18(24)16(23)8-13/h2-4,6-8,10H,5,9H2,1H3,(H,25,28)/t10-/m0/s1 |
| InChIKey | PLDPBUQAZRQICX-JTQLQIEISA-N |
| XLogP | 4.88 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|