C20H16F5N3O2 — CID 155349981
[3-(2,4-difluorophenyl)-6-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(3,4,5-trifluoroanilino)methanol (PubChem CID 155349981) has the molecular formula C20H16F5N3O2 and a molecular weight of 425.36 g/mol. Its IUPAC name is [3-(2,4-difluorophenyl)-6-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(3,4,5-trifluoroanilino)methanol.
| Compound Name | [3-(2,4-difluorophenyl)-6-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(3,4,5-trifluoroanilino)methanol |
|---|---|
| PubChem CID | 155349981 |
| Molecular Formula | C20H16F5N3O2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | [3-(2,4-difluorophenyl)-6-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-(3,4,5-trifluoroanilino)methanol |
| SMILES | CC1Cc2noc(-c3ccc(F)cc3F)c2CN1C(O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C20H16F5N3O2/c1-9-4-17-13(19(30-27-17)12-3-2-10(21)5-14(12)22)8-28(9)20(29)26-11-6-15(23)18(25)16(24)7-11/h2-3,5-7,9,20,26,29H,4,8H2,1H3 |
| InChIKey | IXNQIGZKASVEBA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|