C20H13F5N2O2 — CID 158046639
1-[3-(2,4-difluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(3,4,5-trifluorophenyl)ethanone (PubChem CID 158046639) has the molecular formula C20H13F5N2O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is 1-[3-(2,4-difluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(3,4,5-trifluorophenyl)ethanone.
| Compound Name | 1-[3-(2,4-difluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(3,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 158046639 |
| Molecular Formula | C20H13F5N2O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[3-(2,4-difluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-2-(3,4,5-trifluorophenyl)ethanone |
| SMILES | O=C(Cc1cc(F)c(F)c(F)c1)N1CCc2noc(-c3ccc(F)cc3F)c2C1 |
| InChI | InChI=1S/C20H13F5N2O2/c21-11-1-2-12(14(22)8-11)20-13-9-27(4-3-17(13)26-29-20)18(28)7-10-5-15(23)19(25)16(24)6-10/h1-2,5-6,8H,3-4,7,9H2 |
| InChIKey | FIZKQHWELJFNKQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|