C18H14O — CID 142593040
14-methyl-18-oxatetracyclo[8.8.0.02,7.011,17]octadeca-1(10),2,4,6,8,11(17),12,15-octaene (PubChem CID 142593040) has the molecular formula C18H14O and a molecular weight of 246.31 g/mol. Its IUPAC name is 14-methyl-18-oxatetracyclo[8.8.0.02,7.011,17]octadeca-1(10),2,4,6,8,11(17),12,15-octaene.
| Compound Name | 14-methyl-18-oxatetracyclo[8.8.0.02,7.011,17]octadeca-1(10),2,4,6,8,11(17),12,15-octaene |
|---|---|
| PubChem CID | 142593040 |
| Molecular Formula | C18H14O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 14-methyl-18-oxatetracyclo[8.8.0.02,7.011,17]octadeca-1(10),2,4,6,8,11(17),12,15-octaene |
| SMILES | CC1C=Cc2oc3c(ccc4ccccc43)c2C=C1 |
| InChI | InChI=1S/C18H14O/c1-12-6-9-15-16-10-8-13-4-2-3-5-14(13)18(16)19-17(15)11-7-12/h2-12H,1H3 |
| InChIKey | GLCRPQRFFMVSIQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |