C18H29NO2 — CID 142597114
(5Z,7Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]deca-5,7-dien-2-one (PubChem CID 142597114) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (5Z,7Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]deca-5,7-dien-2-one.
| Compound Name | (5Z,7Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]deca-5,7-dien-2-one |
|---|---|
| PubChem CID | 142597114 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (5Z,7Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]deca-5,7-dien-2-one |
| SMILES | C/C=C\C(=C/C(=C/CC)OC1CC(NC)C1)CCC(C)=O |
| InChI | InChI=1S/C18H29NO2/c1-5-7-15(10-9-14(3)20)11-17(8-6-2)21-18-12-16(13-18)19-4/h5,7-8,11,16,18-19H,6,9-10,12-13H2,1-4H3/b7-5-,15-11+,17-8- |
| InChIKey | JGLOUPNITGGLOR-LTPOYQJOSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|