C16H13N3O3 — CID 142597283
(4E)-2-ethenyl-4-ethylidene-3-methyl-8-nitropyrido[1,2-a]benzimidazol-1-one (PubChem CID 142597283) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is (4E)-2-ethenyl-4-ethylidene-3-methyl-8-nitropyrido[1,2-a]benzimidazol-1-one.
| Compound Name | (4E)-2-ethenyl-4-ethylidene-3-methyl-8-nitropyrido[1,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 142597283 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (4E)-2-ethenyl-4-ethylidene-3-methyl-8-nitropyrido[1,2-a]benzimidazol-1-one |
| SMILES | C=Cc1c(C)/c(=C\C)c2nc3ccc([N+](=O)[O-])cc3n2c1=O |
| InChI | InChI=1S/C16H13N3O3/c1-4-11-9(3)12(5-2)16(20)18-14-8-10(19(21)22)6-7-13(14)17-15(11)18/h4-8H,2H2,1,3H3/b11-4+ |
| InChIKey | GJXNTEUDZZCQCW-NYYWCZLTSA-N |
| XLogP | 2.23 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|