C18H8N4O5 — CID 4573552
7,17-dinitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4(9),5,7,12,14,16,18-nonaen-11-one (PubChem CID 4573552) has the molecular formula C18H8N4O5 and a molecular weight of 360.29 g/mol. Its IUPAC name is 7,17-dinitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4(9),5,7,12,14,16,18-nonaen-11-one.
| Compound Name | 7,17-dinitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4(9),5,7,12,14,16,18-nonaen-11-one |
|---|---|
| PubChem CID | 4573552 |
| Molecular Formula | C18H8N4O5 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 7,17-dinitro-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(20),2,4(9),5,7,12,14,16,18-nonaen-11-one |
| SMILES | O=c1c2cccc3c([N+](=O)[O-])ccc(c32)c2nc3ccc([N+](=O)[O-])cc3n12 |
| InChI | InChI=1S/C18H8N4O5/c23-18-12-3-1-2-10-14(22(26)27)7-5-11(16(10)12)17-19-13-6-4-9(21(24)25)8-15(13)20(17)18/h1-8H |
| InChIKey | KXAZLJWQUJQUMN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|