C12H6Cl2F3N3 — CID 142597884
2,4-dichloro-7-(2,3,4-trifluorophenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine (PubChem CID 142597884) has the molecular formula C12H6Cl2F3N3 and a molecular weight of 320.10 g/mol. Its IUPAC name is 2,4-dichloro-7-(2,3,4-trifluorophenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine.
| Compound Name | 2,4-dichloro-7-(2,3,4-trifluorophenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 142597884 |
| Molecular Formula | C12H6Cl2F3N3 |
| Molecular Weight | 320.10 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 2,4-dichloro-7-(2,3,4-trifluorophenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidine |
| SMILES | Fc1ccc(N2CCc3c(Cl)nc(Cl)nc32)c(F)c1F |
| InChI | InChI=1S/C12H6Cl2F3N3/c13-10-5-3-4-20(11(5)19-12(14)18-10)7-2-1-6(15)8(16)9(7)17/h1-2H,3-4H2 |
| InChIKey | RVNBVDYEUQTHSZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.10 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|