C9H14N6O4 — CID 142601080
methanamine;2-[(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)amino]ethyl nitrite (PubChem CID 142601080) has the molecular formula C9H14N6O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is methanamine;2-[(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)amino]ethyl nitrite.
| Compound Name | methanamine;2-[(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)amino]ethyl nitrite |
|---|---|
| PubChem CID | 142601080 |
| Molecular Formula | C9H14N6O4 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | methanamine;2-[(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)amino]ethyl nitrite |
| SMILES | CN.O=NOCCNc1cnc2c(n1)NC(=O)CO2 |
| InChI | InChI=1S/C8H9N5O4.CH5N/c14-6-4-16-8-7(12-6)11-5(3-10-8)9-1-2-17-13-15;1-2/h3H,1-2,4H2,(H2,9,11,12,14);2H2,1H3 |
| InChIKey | XROSRTMMQXSTEV-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 140.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|