C11H9N7O4 — CID 156861716
6-[5-(2-azidoethyl)-2-oxo-1,3-oxazol-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one (PubChem CID 156861716) has the molecular formula C11H9N7O4 and a molecular weight of 303.24 g/mol. Its IUPAC name is 6-[5-(2-azidoethyl)-2-oxo-1,3-oxazol-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one.
| Compound Name | 6-[5-(2-azidoethyl)-2-oxo-1,3-oxazol-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 156861716 |
| Molecular Formula | C11H9N7O4 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 6-[5-(2-azidoethyl)-2-oxo-1,3-oxazol-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one |
| SMILES | [N-]=[N+]=NCCc1cn(-c2cnc3c(n2)NC(=O)CO3)c(=O)o1 |
| InChI | InChI=1S/C11H9N7O4/c12-17-14-2-1-6-4-18(11(20)22-6)7-3-13-10-9(15-7)16-8(19)5-21-10/h3-4H,1-2,5H2,(H,15,16,19) |
| InChIKey | AALSJCWDEPQINH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 148.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|