C17H29BN2O4 — CID 142603774
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]pyrazole (PubChem CID 142603774) has the molecular formula C17H29BN2O4 and a molecular weight of 336.24 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]pyrazole.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]pyrazole |
|---|---|
| PubChem CID | 142603774 |
| Molecular Formula | C17H29BN2O4 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]pyrazole |
| SMILES | CC1(C)O[C@H](Cn2cc(B3OC(C)(C)C(C)(C)O3)cn2)C(C)(C)O1 |
| InChI | InChI=1S/C17H29BN2O4/c1-14(2)13(21-17(7,8)22-14)11-20-10-12(9-19-20)18-23-15(3,4)16(5,6)24-18/h9-10,13H,11H2,1-8H3/t13-/m1/s1 |
| InChIKey | BTITXAJPIYKWOE-CYBMUJFWSA-N |
| XLogP | 2.11 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|