C17H20N4S4 — CID 142605494
4-[(4,4-diisothiocyanatocyclohexyl)methyl]-1,1-diisothiocyanatocyclohexane (PubChem CID 142605494) has the molecular formula C17H20N4S4 and a molecular weight of 408.64 g/mol. Its IUPAC name is 4-[(4,4-diisothiocyanatocyclohexyl)methyl]-1,1-diisothiocyanatocyclohexane.
| Compound Name | 4-[(4,4-diisothiocyanatocyclohexyl)methyl]-1,1-diisothiocyanatocyclohexane |
|---|---|
| PubChem CID | 142605494 |
| Molecular Formula | C17H20N4S4 |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 4-[(4,4-diisothiocyanatocyclohexyl)methyl]-1,1-diisothiocyanatocyclohexane |
| SMILES | S=C=NC1(N=C=S)CCC(CC2CCC(N=C=S)(N=C=S)CC2)CC1 |
| InChI | InChI=1S/C17H20N4S4/c22-10-18-16(19-11-23)5-1-14(2-6-16)9-15-3-7-17(8-4-15,20-12-24)21-13-25/h14-15H,1-9H2 |
| InChIKey | FCGBVIBZGJNLNN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|