C26H29N3O3S — CID 142606436
2-formamido-8-(1-oxo-2,3-dihydro-1-benzothiophen-6-yl)-N,N-dipropyl-3H-1-benzazepine-4-carboxamide (PubChem CID 142606436) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is 2-formamido-8-(1-oxo-2,3-dihydro-1-benzothiophen-6-yl)-N,N-dipropyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-formamido-8-(1-oxo-2,3-dihydro-1-benzothiophen-6-yl)-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 142606436 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-formamido-8-(1-oxo-2,3-dihydro-1-benzothiophen-6-yl)-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(-c3ccc4c(c3)S(=O)CC4)cc2N=C(NC=O)C1 |
| InChI | InChI=1S/C26H29N3O3S/c1-3-10-29(11-4-2)26(31)22-13-21-8-7-19(14-23(21)28-25(16-22)27-17-30)20-6-5-18-9-12-33(32)24(18)15-20/h5-8,13-15,17H,3-4,9-12,16H2,1-2H3,(H,27,28,30) |
| InChIKey | KLDOQDUGJJELFP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|