C18H25NO — CID 142606835
1-methyl-2-[(E)-oct-1-enyl]-6,7-dihydroquinolin-4-one (PubChem CID 142606835) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 1-methyl-2-[(E)-oct-1-enyl]-6,7-dihydroquinolin-4-one.
| Compound Name | 1-methyl-2-[(E)-oct-1-enyl]-6,7-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 142606835 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 1-methyl-2-[(E)-oct-1-enyl]-6,7-dihydroquinolin-4-one |
| SMILES | CCCCCC/C=C/c1cc(=O)c2c(n1C)=CCCC=2 |
| InChI | InChI=1S/C18H25NO/c1-3-4-5-6-7-8-11-15-14-18(20)16-12-9-10-13-17(16)19(15)2/h8,11-14H,3-7,9-10H2,1-2H3/b11-8+ |
| InChIKey | JGOQGQCWRXUSBO-DHZHZOJOSA-N |
| XLogP | 2.72 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|