C21H23N3O4S — CID 142609227
(E)-2-ethenyl-4-imino-1-(1H-indol-3-yl)but-2-en-1-one;methanol;methyl 2-methyl-1,3-thiazole-4-carboxylate (PubChem CID 142609227) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is (E)-2-ethenyl-4-imino-1-(1H-indol-3-yl)but-2-en-1-one;methanol;methyl 2-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | (E)-2-ethenyl-4-imino-1-(1H-indol-3-yl)but-2-en-1-one;methanol;methyl 2-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 142609227 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (E)-2-ethenyl-4-imino-1-(1H-indol-3-yl)but-2-en-1-one;methanol;methyl 2-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CO.COC(=O)c1csc(C)n1.[H]/N=C/C=C(\C=C)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H12N2O.C6H7NO2S.CH4O/c1-2-10(7-8-15)14(17)12-9-16-13-6-4-3-5-11(12)13;1-4-7-5(3-10-4)6(8)9-2;1-2/h2-9,15-16H,1H2;3H,1-2H3;2H,1H3/b10-7+,15-8+;; |
| InChIKey | RRNSLBRSWWDCQB-ZZFXGWQESA-N |
| XLogP | 3.96 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|