C25H42O5 — CID 142612906
1-(17'-ethoxy-17'-methoxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-10'-yl)ethanol (PubChem CID 142612906) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is 1-(17'-ethoxy-17'-methoxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-10'-yl)ethanol.
| Compound Name | 1-(17'-ethoxy-17'-methoxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-10'-yl)ethanol |
|---|---|
| PubChem CID | 142612906 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 1-(17'-ethoxy-17'-methoxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene]-10'-yl)ethanol |
| SMILES | CCOC1(OC)CCC2C3CCC4CC5(CCC4(C(C)O)C3CCC21C)OCCO5 |
| InChI | InChI=1S/C25H42O5/c1-5-28-25(27-4)11-9-20-19-7-6-18-16-23(29-14-15-30-23)12-13-24(18,17(2)26)21(19)8-10-22(20,25)3/h17-21,26H,5-16H2,1-4H3 |
| InChIKey | ZDIIBVUSLOORAJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|