C28H46O4 — CID 54375409
(4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3,6-trioxocane]-17-yl]pentanal (PubChem CID 54375409) has the molecular formula C28H46O4 and a molecular weight of 446.67 g/mol. Its IUPAC name is (4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3,6-trioxocane]-17-yl]pentanal.
| Compound Name | (4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3,6-trioxocane]-17-yl]pentanal |
|---|---|
| PubChem CID | 54375409 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | (4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3,6-trioxocane]-17-yl]pentanal |
| SMILES | C[C@H](CCC=O)[C@H]1CC[C@H]2[C@@H]3CCC4CC5(CC[C@]4(C)[C@H]3CC[C@]12C)OCCOCCO5 |
| InChI | InChI=1S/C28H46O4/c1-20(5-4-14-29)23-8-9-24-22-7-6-21-19-28(31-17-15-30-16-18-32-28)13-12-26(21,2)25(22)10-11-27(23,24)3/h14,20-25H,4-13,15-19H2,1-3H3/t20-,21?,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | UWDNTLLZVMSZFT-LDHZKLTISA-N |
| XLogP | 6.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|