C28H46O4 — CID 170064986
6-(10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl)-2-methylhexanoic acid (PubChem CID 170064986) has the molecular formula C28H46O4 and a molecular weight of 446.67 g/mol. Its IUPAC name is 6-(10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl)-2-methylhexanoic acid.
| Compound Name | 6-(10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl)-2-methylhexanoic acid |
|---|---|
| PubChem CID | 170064986 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 6-(10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl)-2-methylhexanoic acid |
| SMILES | CC(CCCCC1CCC2C3CCC4CC5(CCC4(C)C3CCC12C)OCCO5)C(=O)O |
| InChI | InChI=1S/C28H46O4/c1-19(25(29)30)6-4-5-7-20-9-11-23-22-10-8-21-18-28(31-16-17-32-28)15-14-27(21,3)24(22)12-13-26(20,23)2/h19-24H,4-18H2,1-3H3,(H,29,30) |
| InChIKey | LAAZMKDMSJJMCE-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|