About 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol
4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol (PubChem CID 142613045) has the molecular formula C23H37N3O2
and a molecular weight of 387.57 g/mol. Its IUPAC name is 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol.
Molecular Properties
| Compound Name | 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol |
| PubChem CID | 142613045 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol |
| SMILES | CCCCCO.Cc1cc(C)n2ncc(C(=O)CCCC3CCCCC3)c2n1 |
| InChI | InChI=1S/C18H25N3O.C5H12O/c1-13-11-14(2)21-18(20-13)16(12-19-21)17(22)10-6-9-15-7-4-3-5-8-15;1-2-3-4-5-6/h11-12,15H,3-10H2,1-2H3;6H,2-5H2,1H3 |
| InChIKey | PLNUNQZXLADMTJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol?
The IUPAC name of 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol (CID 142613045) is 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol.
What is the SMILES notation for 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol?
The canonical SMILES for 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol is CCCCCO.Cc1cc(C)n2ncc(C(=O)CCCC3CCCCC3)c2n1.
What is the InChIKey of 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol?
The InChIKey is PLNUNQZXLADMTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O.C5H12O/c1-13-11-14(2)21-18(20-13)16(12-19-21)17(22)10-6-9-15-7-4-3-5-8-15;1-2-3-4-5-6/h11-12,15H,3-10H2,1-2H3;6H,2-5H2,1H3.
What are the key properties of 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol?
4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol has a molecular weight of 387.57 g/mol, XLogP of 5.45, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)butan-1-one;pentan-1-ol is sourced from PubChem (CID 142613045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).