C17H13N3O3S — CID 142615598
3-[2-(pyridin-3-ylmethylamino)-1,3-thiazole-5-carbonyl]benzoic acid (PubChem CID 142615598) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 3-[2-(pyridin-3-ylmethylamino)-1,3-thiazole-5-carbonyl]benzoic acid.
| Compound Name | 3-[2-(pyridin-3-ylmethylamino)-1,3-thiazole-5-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 142615598 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-[2-(pyridin-3-ylmethylamino)-1,3-thiazole-5-carbonyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C(=O)c2cnc(NCc3cccnc3)s2)c1 |
| InChI | InChI=1S/C17H13N3O3S/c21-15(12-4-1-5-13(7-12)16(22)23)14-10-20-17(24-14)19-9-11-3-2-6-18-8-11/h1-8,10H,9H2,(H,19,20)(H,22,23) |
| InChIKey | PETUGLVTOGGZJT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |