C12H18O — CID 142618294
4-cyclohexa-1,5-dien-1-ylcyclohexan-1-ol (PubChem CID 142618294) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-ylcyclohexan-1-ol.
| Compound Name | 4-cyclohexa-1,5-dien-1-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 142618294 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-ylcyclohexan-1-ol |
| SMILES | OC1CCC(C2=CCCC=C2)CC1 |
| InChI | InChI=1S/C12H18O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h2,4-5,11-13H,1,3,6-9H2 |
| InChIKey | RYWQPYLRAQXEIT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |