C13H20O2 — CID 144554520
2-(4-methylperoxycyclohexyl)cyclohexa-1,3-diene (PubChem CID 144554520) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(4-methylperoxycyclohexyl)cyclohexa-1,3-diene.
| Compound Name | 2-(4-methylperoxycyclohexyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144554520 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-(4-methylperoxycyclohexyl)cyclohexa-1,3-diene |
| SMILES | COOC1CCC(C2=CCCC=C2)CC1 |
| InChI | InChI=1S/C13H20O2/c1-14-15-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h3,5-6,12-13H,2,4,7-10H2,1H3 |
| InChIKey | KOHXEACSJTXESN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|