C17H32O — CID 178142033
cyclohexa-1,5-dien-1-yloxycycloheptane;ethane (PubChem CID 178142033) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yloxycycloheptane;ethane.
| Compound Name | cyclohexa-1,5-dien-1-yloxycycloheptane;ethane |
|---|---|
| PubChem CID | 178142033 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | cyclohexa-1,5-dien-1-yloxycycloheptane;ethane |
| SMILES | C1=CC(OC2CCCCCC2)=CCC1.CC.CC |
| InChI | InChI=1S/C13H20O.2C2H6/c1-2-5-9-12(8-4-1)14-13-10-6-3-7-11-13;2*1-2/h6,10-12H,1-5,7-9H2;2*1-2H3 |
| InChIKey | OAZOEYMGFVVZPS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |