C7H10NO3- — CID 163469111
2-[methoxy(oxido)amino]oxycyclohexa-1,3-diene (PubChem CID 163469111) has the molecular formula C7H10NO3- and a molecular weight of 156.16 g/mol. Its IUPAC name is 2-[methoxy(oxido)amino]oxycyclohexa-1,3-diene.
| Compound Name | 2-[methoxy(oxido)amino]oxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163469111 |
| Molecular Formula | C7H10NO3- |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2-[methoxy(oxido)amino]oxycyclohexa-1,3-diene |
| SMILES | CON([O-])OC1=CCCC=C1 |
| InChI | InChI=1S/C7H10NO3/c1-10-8(9)11-7-5-3-2-4-6-7/h3,5-6H,2,4H2,1H3/q-1 |
| InChIKey | QSWIPQHOVNSUMG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|