C14H23BrN4 — CID 142619227
2-bromo-6-(4-propan-2-yl-1,2,4-triazol-3-yl)pyridine;ethane (PubChem CID 142619227) has the molecular formula C14H23BrN4 and a molecular weight of 327.27 g/mol. Its IUPAC name is 2-bromo-6-(4-propan-2-yl-1,2,4-triazol-3-yl)pyridine;ethane.
| Compound Name | 2-bromo-6-(4-propan-2-yl-1,2,4-triazol-3-yl)pyridine;ethane |
|---|---|
| PubChem CID | 142619227 |
| Molecular Formula | C14H23BrN4 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-bromo-6-(4-propan-2-yl-1,2,4-triazol-3-yl)pyridine;ethane |
| SMILES | CC.CC.CC(C)n1cnnc1-c1cccc(Br)n1 |
| InChI | InChI=1S/C10H11BrN4.2C2H6/c1-7(2)15-6-12-14-10(15)8-4-3-5-9(11)13-8;2*1-2/h3-7H,1-2H3;2*1-2H3 |
| InChIKey | WTMIHAOBTIVLSX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|