C15H25NO2 — CID 142623214
ethane;5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 142623214) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is ethane;5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | ethane;5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142623214 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | ethane;5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C/C=C\C=C(/C)C1CN(C(C)C)C(=O)O1.CC |
| InChI | InChI=1S/C13H19NO2.C2H6/c1-5-6-7-8-11(4)12-9-14(10(2)3)13(15)16-12;1-2/h5-8,10,12H,1,9H2,2-4H3;1-2H3/b7-6-,11-8+; |
| InChIKey | BMABSRNKSCZZCQ-DWROGWBBSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|