C14H22BrNO2 — CID 143838433
5-(bromomethyl)-3-[(2E,5Z)-octa-2,5,7-trien-2-yl]-1,3-oxazolidin-2-one;ethane (PubChem CID 143838433) has the molecular formula C14H22BrNO2 and a molecular weight of 316.24 g/mol. Its IUPAC name is 5-(bromomethyl)-3-[(2E,5Z)-octa-2,5,7-trien-2-yl]-1,3-oxazolidin-2-one;ethane.
| Compound Name | 5-(bromomethyl)-3-[(2E,5Z)-octa-2,5,7-trien-2-yl]-1,3-oxazolidin-2-one;ethane |
|---|---|
| PubChem CID | 143838433 |
| Molecular Formula | C14H22BrNO2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 5-(bromomethyl)-3-[(2E,5Z)-octa-2,5,7-trien-2-yl]-1,3-oxazolidin-2-one;ethane |
| SMILES | C=C/C=C\C/C=C(\C)N1CC(CBr)OC1=O.CC |
| InChI | InChI=1S/C12H16BrNO2.C2H6/c1-3-4-5-6-7-10(2)14-9-11(8-13)16-12(14)15;1-2/h3-5,7,11H,1,6,8-9H2,2H3;1-2H3/b5-4-,10-7+; |
| InChIKey | MLRFSAUXQJBFNI-FDLCTBCBSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|