C23H29F2N3O3 — CID 88889242
N-[[(5S)-3-[(2E,4Z)-4-fluoro-5-[4-[(3-fluoropropylamino)methyl]phenyl]hepta-2,4,6-trien-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 88889242) has the molecular formula C23H29F2N3O3 and a molecular weight of 433.50 g/mol. Its IUPAC name is N-[[(5S)-3-[(2E,4Z)-4-fluoro-5-[4-[(3-fluoropropylamino)methyl]phenyl]hepta-2,4,6-trien-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[(2E,4Z)-4-fluoro-5-[4-[(3-fluoropropylamino)methyl]phenyl]hepta-2,4,6-trien-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 88889242 |
| Molecular Formula | C23H29F2N3O3 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-[[(5S)-3-[(2E,4Z)-4-fluoro-5-[4-[(3-fluoropropylamino)methyl]phenyl]hepta-2,4,6-trien-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | C=C/C(=C(F)\C=C(/C)N1C[C@H](CNC(C)=O)OC1=O)c1ccc(CNCCCF)cc1 |
| InChI | InChI=1S/C23H29F2N3O3/c1-4-21(19-8-6-18(7-9-19)13-26-11-5-10-24)22(25)12-16(2)28-15-20(31-23(28)30)14-27-17(3)29/h4,6-9,12,20,26H,1,5,10-11,13-15H2,2-3H3,(H,27,29)/b16-12+,22-21-/t20-/m0/s1 |
| InChIKey | KOKGBGBYTYUZIM-YLHZGMEQSA-N |
| XLogP | 3.86 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|