C18H29N3O6 — CID 144658188
ethane;formaldehyde;N-[[2-oxo-3-[(2E,4Z)-6-(3-oxomorpholin-4-yl)hexa-2,4-dien-3-yl]-1,3-oxazolidin-5-yl]methyl]formamide (PubChem CID 144658188) has the molecular formula C18H29N3O6 and a molecular weight of 383.45 g/mol. Its IUPAC name is ethane;formaldehyde;N-[[2-oxo-3-[(2E,4Z)-6-(3-oxomorpholin-4-yl)hexa-2,4-dien-3-yl]-1,3-oxazolidin-5-yl]methyl]formamide.
| Compound Name | ethane;formaldehyde;N-[[2-oxo-3-[(2E,4Z)-6-(3-oxomorpholin-4-yl)hexa-2,4-dien-3-yl]-1,3-oxazolidin-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 144658188 |
| Molecular Formula | C18H29N3O6 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | ethane;formaldehyde;N-[[2-oxo-3-[(2E,4Z)-6-(3-oxomorpholin-4-yl)hexa-2,4-dien-3-yl]-1,3-oxazolidin-5-yl]methyl]formamide |
| SMILES | C/C=C(\C=C/CN1CCOCC1=O)N1CC(CNC=O)OC1=O.C=O.CC |
| InChI | InChI=1S/C15H21N3O5.C2H6.CH2O/c1-2-12(4-3-5-17-6-7-22-10-14(17)20)18-9-13(8-16-11-19)23-15(18)21;2*1-2/h2-4,11,13H,5-10H2,1H3,(H,16,19);1-2H3;1H2/b4-3-,12-2+;; |
| InChIKey | BWYACXFPQBIBOU-CGASNGTHSA-N |
| XLogP | 0.71 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|