C14H25NO2 — CID 143448351
ethane;(3S)-1-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methylazetidin-2-one;methanol (PubChem CID 143448351) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is ethane;(3S)-1-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methylazetidin-2-one;methanol.
| Compound Name | ethane;(3S)-1-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methylazetidin-2-one;methanol |
|---|---|
| PubChem CID | 143448351 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | ethane;(3S)-1-[(2Z,4Z)-hepta-2,4,6-trienyl]-3-methylazetidin-2-one;methanol |
| SMILES | C=C/C=C\C=C/CN1C[C@H](C)C1=O.CC.CO |
| InChI | InChI=1S/C11H15NO.C2H6.CH4O/c1-3-4-5-6-7-8-12-9-10(2)11(12)13;2*1-2/h3-7,10H,1,8-9H2,2H3;1-2H3;2H,1H3/b5-4-,7-6-;;/t10-;;/m0../s1 |
| InChIKey | JTBYHIGKPLSVSF-NEQOUCBMSA-N |
| XLogP | 2.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|