C13H28Si — CID 142625906
2-(2,2-dimethylpropyl)pent-4-enyl-trimethylsilane (PubChem CID 142625906) has the molecular formula C13H28Si and a molecular weight of 212.45 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)pent-4-enyl-trimethylsilane.
| Compound Name | 2-(2,2-dimethylpropyl)pent-4-enyl-trimethylsilane |
|---|---|
| PubChem CID | 142625906 |
| Molecular Formula | C13H28Si |
| Molecular Weight | 212.45 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | 2-(2,2-dimethylpropyl)pent-4-enyl-trimethylsilane |
| SMILES | C=CCC(CC(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C13H28Si/c1-8-9-12(10-13(2,3)4)11-14(5,6)7/h8,12H,1,9-11H2,2-7H3 |
| InChIKey | KUEDQGNERIWUNV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|