C6H14N2O4S — CID 142626015
(2R)-2-hydrazinyl-3-methyl-3-methylsulfonylbutanoic acid (PubChem CID 142626015) has the molecular formula C6H14N2O4S and a molecular weight of 210.25 g/mol. Its IUPAC name is (2R)-2-hydrazinyl-3-methyl-3-methylsulfonylbutanoic acid.
| Compound Name | (2R)-2-hydrazinyl-3-methyl-3-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 142626015 |
| Molecular Formula | C6H14N2O4S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | (2R)-2-hydrazinyl-3-methyl-3-methylsulfonylbutanoic acid |
| SMILES | CC(C)([C@H](NN)C(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C6H14N2O4S/c1-6(2,13(3,11)12)4(8-7)5(9)10/h4,8H,7H2,1-3H3,(H,9,10)/t4-/m1/s1 |
| InChIKey | BKQAZLWQLZBQFK-SCSAIBSYSA-N |
| XLogP | -1.27 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|