C6H5BrClNOS — CID 142626123
2-bromo-4-ethyl-1,3-thiazole-5-carbonyl chloride (PubChem CID 142626123) has the molecular formula C6H5BrClNOS and a molecular weight of 254.54 g/mol. Its IUPAC name is 2-bromo-4-ethyl-1,3-thiazole-5-carbonyl chloride.
| Compound Name | 2-bromo-4-ethyl-1,3-thiazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 142626123 |
| Molecular Formula | C6H5BrClNOS |
| Molecular Weight | 254.54 g/mol |
| Exact Mass | 252.90 |
| IUPAC Name | 2-bromo-4-ethyl-1,3-thiazole-5-carbonyl chloride |
| SMILES | CCc1nc(Br)sc1C(=O)Cl |
| InChI | InChI=1S/C6H5BrClNOS/c1-2-3-4(5(8)10)11-6(7)9-3/h2H2,1H3 |
| InChIKey | FJWKISPCIDEABJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|